C16H19NO3 — CID 122619687
methyl 1'-formylspiro[6,8-dihydro-5H-naphthalene-7,3'-pyrrolidine]-2-carboxylate (PubChem CID 122619687) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is methyl 1'-formylspiro[6,8-dihydro-5H-naphthalene-7,3'-pyrrolidine]-2-carboxylate.
| Compound Name | methyl 1'-formylspiro[6,8-dihydro-5H-naphthalene-7,3'-pyrrolidine]-2-carboxylate |
|---|---|
| PubChem CID | 122619687 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | methyl 1'-formylspiro[6,8-dihydro-5H-naphthalene-7,3'-pyrrolidine]-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CC1(CC2)CCN(C=O)C1 |
| InChI | InChI=1S/C16H19NO3/c1-20-15(19)13-3-2-12-4-5-16(9-14(12)8-13)6-7-17(10-16)11-18/h2-3,8,11H,4-7,9-10H2,1H3 |
| InChIKey | YLHJVPYZWKTRSN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|