C12H16BNO3 — CID 156679995
(7-methoxycarbonyl-3,4-dihydro-1H-isoquinolin-2-yl)-methylborinic acid (PubChem CID 156679995) has the molecular formula C12H16BNO3 and a molecular weight of 233.08 g/mol. Its IUPAC name is (7-methoxycarbonyl-3,4-dihydro-1H-isoquinolin-2-yl)-methylborinic acid.
| Compound Name | (7-methoxycarbonyl-3,4-dihydro-1H-isoquinolin-2-yl)-methylborinic acid |
|---|---|
| PubChem CID | 156679995 |
| Molecular Formula | C12H16BNO3 |
| Molecular Weight | 233.08 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (7-methoxycarbonyl-3,4-dihydro-1H-isoquinolin-2-yl)-methylborinic acid |
| SMILES | COC(=O)c1ccc2c(c1)CN(B(C)O)CC2 |
| InChI | InChI=1S/C12H16BNO3/c1-13(16)14-6-5-9-3-4-10(12(15)17-2)7-11(9)8-14/h3-4,7,16H,5-6,8H2,1-2H3 |
| InChIKey | LFARYYFVONTJQM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.08 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|