methyl 1-pyrimidin-5-yl-2,3-dihydroindole-6-carboxylate

C14H13N3O2 — CID 165142456

IUPACmethyl 1-pyrimidin-5-yl-2,3-dihydroindole-6-carboxylate
SMILESCOC(=O)c1ccc2c(c1)N(c1cncnc1)CC2
InChIInChI=1S/C14H13N3O2/c1-19-14(18)11-3-2-10-4-5-17(13(10)6-11)12-7-15-9-16-8-12/h2-3,6-9H,4-5H2,1H3
InChIKeyXKRXBHSQQPFNOC-UHFFFAOYSA-N
MW255.28 g/mol
LogP1.96
Rot. Bonds2

About methyl 1-pyrimidin-5-yl-2,3-dihydroindole-6-carboxylate

methyl 1-pyrimidin-5-yl-2,3-dihydroindole-6-carboxylate (PubChem CID 165142456) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is methyl 1-pyrimidin-5-yl-2,3-dihydroindole-6-carboxylate.

Molecular Properties

Compound Namemethyl 1-pyrimidin-5-yl-2,3-dihydroindole-6-carboxylate
PubChem CID165142456
Molecular FormulaC14H13N3O2
Molecular Weight255.28 g/mol
Exact Mass255.10
IUPAC Namemethyl 1-pyrimidin-5-yl-2,3-dihydroindole-6-carboxylate
SMILESCOC(=O)c1ccc2c(c1)N(c1cncnc1)CC2
InChIInChI=1S/C14H13N3O2/c1-19-14(18)11-3-2-10-4-5-17(13(10)6-11)12-7-15-9-16-8-12/h2-3,6-9H,4-5H2,1H3
InChIKeyXKRXBHSQQPFNOC-UHFFFAOYSA-N
XLogP1.96
TPSA55.32 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.28
LogP ≤ 51.96
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 1-pyrimidin-5-yl-2,3-dihydroindole-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-pyrimidin-5-yl-2,3-dihydroindole-6-carboxylate?
The IUPAC name of methyl 1-pyrimidin-5-yl-2,3-dihydroindole-6-carboxylate (CID 165142456) is methyl 1-pyrimidin-5-yl-2,3-dihydroindole-6-carboxylate.
What is the SMILES notation for methyl 1-pyrimidin-5-yl-2,3-dihydroindole-6-carboxylate?
The canonical SMILES for methyl 1-pyrimidin-5-yl-2,3-dihydroindole-6-carboxylate is COC(=O)c1ccc2c(c1)N(c1cncnc1)CC2.
What is the InChIKey of methyl 1-pyrimidin-5-yl-2,3-dihydroindole-6-carboxylate?
The InChIKey is XKRXBHSQQPFNOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2/c1-19-14(18)11-3-2-10-4-5-17(13(10)6-11)12-7-15-9-16-8-12/h2-3,6-9H,4-5H2,1H3.
What are the key properties of methyl 1-pyrimidin-5-yl-2,3-dihydroindole-6-carboxylate?
methyl 1-pyrimidin-5-yl-2,3-dihydroindole-6-carboxylate has a molecular weight of 255.28 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-pyrimidin-5-yl-2,3-dihydroindole-6-carboxylate is sourced from PubChem (CID 165142456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).