C14H18N2O4 — CID 101363600
dimethyl 3-(dimethylamino)-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate (PubChem CID 101363600) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is dimethyl 3-(dimethylamino)-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate.
| Compound Name | dimethyl 3-(dimethylamino)-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate |
|---|---|
| PubChem CID | 101363600 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | dimethyl 3-(dimethylamino)-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2cnc(N(C)C)cc2C1 |
| InChI | InChI=1S/C14H18N2O4/c1-16(2)11-5-9-6-14(12(17)19-3,13(18)20-4)7-10(9)8-15-11/h5,8H,6-7H2,1-4H3 |
| InChIKey | GOBCLBIOMFPCPG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|