C25H24O7 — CID 132990625
dimethyl 1,3-bis(4-methoxyphenyl)-4,6-dihydrocyclopenta[c]furan-5,5-dicarboxylate (PubChem CID 132990625) has the molecular formula C25H24O7 and a molecular weight of 436.46 g/mol. Its IUPAC name is dimethyl 1,3-bis(4-methoxyphenyl)-4,6-dihydrocyclopenta[c]furan-5,5-dicarboxylate.
| Compound Name | dimethyl 1,3-bis(4-methoxyphenyl)-4,6-dihydrocyclopenta[c]furan-5,5-dicarboxylate |
|---|---|
| PubChem CID | 132990625 |
| Molecular Formula | C25H24O7 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | dimethyl 1,3-bis(4-methoxyphenyl)-4,6-dihydrocyclopenta[c]furan-5,5-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2c(-c3ccc(OC)cc3)oc(-c3ccc(OC)cc3)c2C1 |
| InChI | InChI=1S/C25H24O7/c1-28-17-9-5-15(6-10-17)21-19-13-25(23(26)30-3,24(27)31-4)14-20(19)22(32-21)16-7-11-18(29-2)12-8-16/h5-12H,13-14H2,1-4H3 |
| InChIKey | JLXMMHUIJKWHRI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|