C24H23N5O5 — CID 143548424
methyl 4-[4-(4-carbonazidoylphenyl)-5-(4-methoxyphenyl)-1,3-oxazol-2-yl]piperidine-4-carboxylate (PubChem CID 143548424) has the molecular formula C24H23N5O5 and a molecular weight of 461.48 g/mol. Its IUPAC name is methyl 4-[4-(4-carbonazidoylphenyl)-5-(4-methoxyphenyl)-1,3-oxazol-2-yl]piperidine-4-carboxylate.
| Compound Name | methyl 4-[4-(4-carbonazidoylphenyl)-5-(4-methoxyphenyl)-1,3-oxazol-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 143548424 |
| Molecular Formula | C24H23N5O5 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | methyl 4-[4-(4-carbonazidoylphenyl)-5-(4-methoxyphenyl)-1,3-oxazol-2-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1(c2nc(-c3ccc(C(=O)N=[N+]=[N-])cc3)c(-c3ccc(OC)cc3)o2)CCNCC1 |
| InChI | InChI=1S/C24H23N5O5/c1-32-18-9-7-16(8-10-18)20-19(15-3-5-17(6-4-15)21(30)28-29-25)27-22(34-20)24(23(31)33-2)11-13-26-14-12-24/h3-10,26H,11-14H2,1-2H3 |
| InChIKey | HCHZZYHSRJIRGN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 139.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|