C25H27N3O7 — CID 59486570
2-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]-1-[hydroxy(methyl)carbamoyl]piperidine-2-carboxylic acid (PubChem CID 59486570) has the molecular formula C25H27N3O7 and a molecular weight of 481.51 g/mol. Its IUPAC name is 2-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]-1-[hydroxy(methyl)carbamoyl]piperidine-2-carboxylic acid.
| Compound Name | 2-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]-1-[hydroxy(methyl)carbamoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 59486570 |
| Molecular Formula | C25H27N3O7 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 2-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]-1-[hydroxy(methyl)carbamoyl]piperidine-2-carboxylic acid |
| SMILES | COc1ccc(-c2nc(C3(C(=O)O)CCCCN3C(=O)N(C)O)oc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H27N3O7/c1-27(32)24(31)28-15-5-4-14-25(28,23(29)30)22-26-20(16-6-10-18(33-2)11-7-16)21(35-22)17-8-12-19(34-3)13-9-17/h6-13,32H,4-5,14-15H2,1-3H3,(H,29,30) |
| InChIKey | SVZUAXVFNJSUNP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|