C26H31N3O5 — CID 59486528
N-hydroxy-4-[5-(4-methoxyphenyl)-4-(4-propan-2-yloxyphenyl)-1,3-oxazol-2-yl]-N-methylpiperidine-1-carboxamide (PubChem CID 59486528) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is N-hydroxy-4-[5-(4-methoxyphenyl)-4-(4-propan-2-yloxyphenyl)-1,3-oxazol-2-yl]-N-methylpiperidine-1-carboxamide.
| Compound Name | N-hydroxy-4-[5-(4-methoxyphenyl)-4-(4-propan-2-yloxyphenyl)-1,3-oxazol-2-yl]-N-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 59486528 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | N-hydroxy-4-[5-(4-methoxyphenyl)-4-(4-propan-2-yloxyphenyl)-1,3-oxazol-2-yl]-N-methylpiperidine-1-carboxamide |
| SMILES | COc1ccc(-c2oc(C3CCN(C(=O)N(C)O)CC3)nc2-c2ccc(OC(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H31N3O5/c1-17(2)33-22-11-5-18(6-12-22)23-24(19-7-9-21(32-4)10-8-19)34-25(27-23)20-13-15-29(16-14-20)26(30)28(3)31/h5-12,17,20,31H,13-16H2,1-4H3 |
| InChIKey | VJQGSZNQHGYMPK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|