C29H37N3O4 — CID 59486680
4-[5-(4-tert-butylphenyl)-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]-N-hydroxy-N-propan-2-ylpiperidine-1-carboxamide (PubChem CID 59486680) has the molecular formula C29H37N3O4 and a molecular weight of 491.63 g/mol. Its IUPAC name is 4-[5-(4-tert-butylphenyl)-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]-N-hydroxy-N-propan-2-ylpiperidine-1-carboxamide.
| Compound Name | 4-[5-(4-tert-butylphenyl)-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]-N-hydroxy-N-propan-2-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 59486680 |
| Molecular Formula | C29H37N3O4 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | 4-[5-(4-tert-butylphenyl)-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]-N-hydroxy-N-propan-2-ylpiperidine-1-carboxamide |
| SMILES | COc1ccc(-c2nc(C3CCN(C(=O)N(O)C(C)C)CC3)oc2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H37N3O4/c1-19(2)32(34)28(33)31-17-15-22(16-18-31)27-30-25(20-9-13-24(35-6)14-10-20)26(36-27)21-7-11-23(12-8-21)29(3,4)5/h7-14,19,22,34H,15-18H2,1-6H3 |
| InChIKey | SFPKMNFQUVPBSN-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|