C26H32N4O3 — CID 59486572
N-hydroxy-4-[1-(4-methoxyphenyl)-5-(4-methylphenyl)pyrazol-3-yl]-N-propan-2-ylpiperidine-1-carboxamide (PubChem CID 59486572) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is N-hydroxy-4-[1-(4-methoxyphenyl)-5-(4-methylphenyl)pyrazol-3-yl]-N-propan-2-ylpiperidine-1-carboxamide.
| Compound Name | N-hydroxy-4-[1-(4-methoxyphenyl)-5-(4-methylphenyl)pyrazol-3-yl]-N-propan-2-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 59486572 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | N-hydroxy-4-[1-(4-methoxyphenyl)-5-(4-methylphenyl)pyrazol-3-yl]-N-propan-2-ylpiperidine-1-carboxamide |
| SMILES | COc1ccc(-n2nc(C3CCN(C(=O)N(O)C(C)C)CC3)cc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H32N4O3/c1-18(2)30(32)26(31)28-15-13-20(14-16-28)24-17-25(21-7-5-19(3)6-8-21)29(27-24)22-9-11-23(33-4)12-10-22/h5-12,17-18,20,32H,13-16H2,1-4H3 |
| InChIKey | SMWRPDMSGSMGHI-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|