C25H28N4O5 — CID 145464425
3-[1-[hydroxy(methyl)carbamoyl]piperidin-4-yl]-1-(4-methoxyphenyl)-5-(4-methylphenyl)pyrazole-4-carboxylic acid (PubChem CID 145464425) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is 3-[1-[hydroxy(methyl)carbamoyl]piperidin-4-yl]-1-(4-methoxyphenyl)-5-(4-methylphenyl)pyrazole-4-carboxylic acid.
| Compound Name | 3-[1-[hydroxy(methyl)carbamoyl]piperidin-4-yl]-1-(4-methoxyphenyl)-5-(4-methylphenyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 145464425 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 3-[1-[hydroxy(methyl)carbamoyl]piperidin-4-yl]-1-(4-methoxyphenyl)-5-(4-methylphenyl)pyrazole-4-carboxylic acid |
| SMILES | COc1ccc(-n2nc(C3CCN(C(=O)N(C)O)CC3)c(C(=O)O)c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H28N4O5/c1-16-4-6-18(7-5-16)23-21(24(30)31)22(17-12-14-28(15-13-17)25(32)27(2)33)26-29(23)19-8-10-20(34-3)11-9-19/h4-11,17,33H,12-15H2,1-3H3,(H,30,31) |
| InChIKey | MLGJXSLKOHGOMO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|