C27H34N4O4 — CID 59486697
N-ethyl-4-[1-ethyl-4,5-bis(4-methoxyphenyl)imidazol-2-yl]-N-hydroxypiperidine-1-carboxamide (PubChem CID 59486697) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is N-ethyl-4-[1-ethyl-4,5-bis(4-methoxyphenyl)imidazol-2-yl]-N-hydroxypiperidine-1-carboxamide.
| Compound Name | N-ethyl-4-[1-ethyl-4,5-bis(4-methoxyphenyl)imidazol-2-yl]-N-hydroxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 59486697 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | N-ethyl-4-[1-ethyl-4,5-bis(4-methoxyphenyl)imidazol-2-yl]-N-hydroxypiperidine-1-carboxamide |
| SMILES | CCN(O)C(=O)N1CCC(c2nc(-c3ccc(OC)cc3)c(-c3ccc(OC)cc3)n2CC)CC1 |
| InChI | InChI=1S/C27H34N4O4/c1-5-30-25(20-9-13-23(35-4)14-10-20)24(19-7-11-22(34-3)12-8-19)28-26(30)21-15-17-29(18-16-21)27(32)31(33)6-2/h7-14,21,33H,5-6,15-18H2,1-4H3 |
| InChIKey | JZLQBIIHPRHHGJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|