C23H24ClN3O3S — CID 59486852
4-[5-(4-chlorophenyl)-4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide (PubChem CID 59486852) has the molecular formula C23H24ClN3O3S and a molecular weight of 457.98 g/mol. Its IUPAC name is 4-[5-(4-chlorophenyl)-4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide.
| Compound Name | 4-[5-(4-chlorophenyl)-4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 59486852 |
| Molecular Formula | C23H24ClN3O3S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 4-[5-(4-chlorophenyl)-4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide |
| SMILES | COc1ccc(-c2nc(C3CCN(C(=O)N(C)O)CC3)sc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H24ClN3O3S/c1-26(29)23(28)27-13-11-17(12-14-27)22-25-20(15-5-9-19(30-2)10-6-15)21(31-22)16-3-7-18(24)8-4-16/h3-10,17,29H,11-14H2,1-2H3 |
| InChIKey | YHQPFFIEAAJIJV-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|