C24H29N5O4 — CID 145464423
4-[4-amino-1,5-bis(4-methoxyphenyl)pyrazol-3-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide (PubChem CID 145464423) has the molecular formula C24H29N5O4 and a molecular weight of 451.53 g/mol. Its IUPAC name is 4-[4-amino-1,5-bis(4-methoxyphenyl)pyrazol-3-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide.
| Compound Name | 4-[4-amino-1,5-bis(4-methoxyphenyl)pyrazol-3-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 145464423 |
| Molecular Formula | C24H29N5O4 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 4-[4-amino-1,5-bis(4-methoxyphenyl)pyrazol-3-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide |
| SMILES | COc1ccc(-c2c(N)c(C3CCN(C(=O)N(C)O)CC3)nn2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H29N5O4/c1-27(31)24(30)28-14-12-16(13-15-28)22-21(25)23(17-4-8-19(32-2)9-5-17)29(26-22)18-6-10-20(33-3)11-7-18/h4-11,16,31H,12-15,25H2,1-3H3 |
| InChIKey | DXEBRGFSMQAENJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|