C23H27N3O2 — CID 145464422
4-[1,5-bis(4-methoxyphenyl)-4-methylpyrazol-3-yl]piperidine (PubChem CID 145464422) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-[1,5-bis(4-methoxyphenyl)-4-methylpyrazol-3-yl]piperidine.
| Compound Name | 4-[1,5-bis(4-methoxyphenyl)-4-methylpyrazol-3-yl]piperidine |
|---|---|
| PubChem CID | 145464422 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 4-[1,5-bis(4-methoxyphenyl)-4-methylpyrazol-3-yl]piperidine |
| SMILES | COc1ccc(-c2c(C)c(C3CCNCC3)nn2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H27N3O2/c1-16-22(17-12-14-24-15-13-17)25-26(19-6-10-21(28-3)11-7-19)23(16)18-4-8-20(27-2)9-5-18/h4-11,17,24H,12-15H2,1-3H3 |
| InChIKey | XBYGCLOOTIUCSA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |