C25H29N3O5 — CID 59486654
4-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]-N-methoxy-N-methylpiperidine-1-carboxamide (PubChem CID 59486654) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is 4-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]-N-methoxy-N-methylpiperidine-1-carboxamide.
| Compound Name | 4-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]-N-methoxy-N-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 59486654 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 4-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]-N-methoxy-N-methylpiperidine-1-carboxamide |
| SMILES | COc1ccc(-c2nc(C3CCN(C(=O)N(C)OC)CC3)oc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H29N3O5/c1-27(32-4)25(29)28-15-13-19(14-16-28)24-26-22(17-5-9-20(30-2)10-6-17)23(33-24)18-7-11-21(31-3)12-8-18/h5-12,19H,13-16H2,1-4H3 |
| InChIKey | XBGVZCGRKYCUEC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 77.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|