C25H26F3N3O4 — CID 59486748
N-ethyl-N-hydroxy-4-[4-(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]piperidine-1-carboxamide (PubChem CID 59486748) has the molecular formula C25H26F3N3O4 and a molecular weight of 489.49 g/mol. Its IUPAC name is N-ethyl-N-hydroxy-4-[4-(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]piperidine-1-carboxamide.
| Compound Name | N-ethyl-N-hydroxy-4-[4-(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 59486748 |
| Molecular Formula | C25H26F3N3O4 |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | N-ethyl-N-hydroxy-4-[4-(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]piperidine-1-carboxamide |
| SMILES | CCN(O)C(=O)N1CCC(c2nc(-c3ccc(OC)cc3)c(-c3ccc(C(F)(F)F)cc3)o2)CC1 |
| InChI | InChI=1S/C25H26F3N3O4/c1-3-31(33)24(32)30-14-12-18(13-15-30)23-29-21(16-6-10-20(34-2)11-7-16)22(35-23)17-4-8-19(9-5-17)25(26,27)28/h4-11,18,33H,3,12-15H2,1-2H3 |
| InChIKey | SERHZNXNAJFXON-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|