C24H21F3N4O3 — CID 162554624
N-(cyanomethyl)-N-hydroxy-4-[5-phenyl-4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]piperidine-1-carboxamide (PubChem CID 162554624) has the molecular formula C24H21F3N4O3 and a molecular weight of 470.45 g/mol. Its IUPAC name is N-(cyanomethyl)-N-hydroxy-4-[5-phenyl-4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]piperidine-1-carboxamide.
| Compound Name | N-(cyanomethyl)-N-hydroxy-4-[5-phenyl-4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 162554624 |
| Molecular Formula | C24H21F3N4O3 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | N-(cyanomethyl)-N-hydroxy-4-[5-phenyl-4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]piperidine-1-carboxamide |
| SMILES | N#CCN(O)C(=O)N1CCC(c2nc(-c3ccc(C(F)(F)F)cc3)c(-c3ccccc3)o2)CC1 |
| InChI | InChI=1S/C24H21F3N4O3/c25-24(26,27)19-8-6-16(7-9-19)20-21(17-4-2-1-3-5-17)34-22(29-20)18-10-13-30(14-11-18)23(32)31(33)15-12-28/h1-9,18,33H,10-11,13-15H2 |
| InChIKey | BGUJNYPBPQGLFF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 93.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|