C26H29N3O7 — CID 59486996
methyl 1-[hydroxy(methyl)carbamoyl]-4-[5-(3-methoxyphenyl)-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]piperidine-4-carboxylate (PubChem CID 59486996) has the molecular formula C26H29N3O7 and a molecular weight of 495.53 g/mol. Its IUPAC name is methyl 1-[hydroxy(methyl)carbamoyl]-4-[5-(3-methoxyphenyl)-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[hydroxy(methyl)carbamoyl]-4-[5-(3-methoxyphenyl)-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 59486996 |
| Molecular Formula | C26H29N3O7 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | methyl 1-[hydroxy(methyl)carbamoyl]-4-[5-(3-methoxyphenyl)-4-(4-methoxyphenyl)-1,3-oxazol-2-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1(c2nc(-c3ccc(OC)cc3)c(-c3cccc(OC)c3)o2)CCN(C(=O)N(C)O)CC1 |
| InChI | InChI=1S/C26H29N3O7/c1-28(32)25(31)29-14-12-26(13-15-29,24(30)35-4)23-27-21(17-8-10-19(33-2)11-9-17)22(36-23)18-6-5-7-20(16-18)34-3/h5-11,16,32H,12-15H2,1-4H3 |
| InChIKey | QRCVDJZHNBOCDD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 114.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|