C26H30N4O6 — CID 59486837
methyl 1-[hydroxy(methyl)carbamoyl]-4-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)pyrazol-3-yl]piperidine-4-carboxylate (PubChem CID 59486837) has the molecular formula C26H30N4O6 and a molecular weight of 494.55 g/mol. Its IUPAC name is methyl 1-[hydroxy(methyl)carbamoyl]-4-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)pyrazol-3-yl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[hydroxy(methyl)carbamoyl]-4-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)pyrazol-3-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 59486837 |
| Molecular Formula | C26H30N4O6 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | methyl 1-[hydroxy(methyl)carbamoyl]-4-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)pyrazol-3-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1(c2cc(-c3ccc(OC)cc3)n(-c3cccc(OC)c3)n2)CCN(C(=O)N(C)O)CC1 |
| InChI | InChI=1S/C26H30N4O6/c1-28(33)25(32)29-14-12-26(13-15-29,24(31)36-4)23-17-22(18-8-10-20(34-2)11-9-18)30(27-23)19-6-5-7-21(16-19)35-3/h5-11,16-17,33H,12-15H2,1-4H3 |
| InChIKey | KKTZZYAOZSYRFX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|