C19H25BO6 — CID 102184577
dimethyl 5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-4-methyl-1,3-dihydroindene-2,2-dicarboxylate (PubChem CID 102184577) has the molecular formula C19H25BO6 and a molecular weight of 360.22 g/mol. Its IUPAC name is dimethyl 5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-4-methyl-1,3-dihydroindene-2,2-dicarboxylate.
| Compound Name | dimethyl 5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-4-methyl-1,3-dihydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102184577 |
| Molecular Formula | C19H25BO6 |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | dimethyl 5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-4-methyl-1,3-dihydroindene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2ccc(B3OCC(C)(C)CO3)c(C)c2C1 |
| InChI | InChI=1S/C19H25BO6/c1-12-14-9-19(16(21)23-4,17(22)24-5)8-13(14)6-7-15(12)20-25-10-18(2,3)11-26-20/h6-7H,8-11H2,1-5H3 |
| InChIKey | PAJYCAPLQJQVPE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|