C13H16BClO4 — CID 53433864
methyl 4-chloro-2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzoate (PubChem CID 53433864) has the molecular formula C13H16BClO4 and a molecular weight of 282.53 g/mol. Its IUPAC name is methyl 4-chloro-2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzoate.
| Compound Name | methyl 4-chloro-2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzoate |
|---|---|
| PubChem CID | 53433864 |
| Molecular Formula | C13H16BClO4 |
| Molecular Weight | 282.53 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | methyl 4-chloro-2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzoate |
| SMILES | COC(=O)c1ccc(Cl)cc1B1OCC(C)(C)CO1 |
| InChI | InChI=1S/C13H16BClO4/c1-13(2)7-18-14(19-8-13)11-6-9(15)4-5-10(11)12(16)17-3/h4-6H,7-8H2,1-3H3 |
| InChIKey | KWCHJESNALGBLI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.53 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|