C12H16BFO3 — CID 53433664
2-(5-fluoro-2-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane (PubChem CID 53433664) has the molecular formula C12H16BFO3 and a molecular weight of 238.07 g/mol. Its IUPAC name is 2-(5-fluoro-2-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane.
| Compound Name | 2-(5-fluoro-2-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 53433664 |
| Molecular Formula | C12H16BFO3 |
| Molecular Weight | 238.07 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-(5-fluoro-2-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| SMILES | COc1ccc(F)cc1B1OCC(C)(C)CO1 |
| InChI | InChI=1S/C12H16BFO3/c1-12(2)7-16-13(17-8-12)10-6-9(14)4-5-11(10)15-3/h4-6H,7-8H2,1-3H3 |
| InChIKey | LGSJYOWZFFRZRY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.07 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|