C15H14BFO2 — CID 24831187
5-fluoro-1-(2-methoxy-5-methylphenyl)-3H-2,1-benzoxaborole (PubChem CID 24831187) has the molecular formula C15H14BFO2 and a molecular weight of 256.08 g/mol. Its IUPAC name is 5-fluoro-1-(2-methoxy-5-methylphenyl)-3H-2,1-benzoxaborole.
| Compound Name | 5-fluoro-1-(2-methoxy-5-methylphenyl)-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 24831187 |
| Molecular Formula | C15H14BFO2 |
| Molecular Weight | 256.08 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 5-fluoro-1-(2-methoxy-5-methylphenyl)-3H-2,1-benzoxaborole |
| SMILES | COc1ccc(C)cc1B1OCc2cc(F)ccc21 |
| InChI | InChI=1S/C15H14BFO2/c1-10-3-6-15(18-2)14(7-10)16-13-5-4-12(17)8-11(13)9-19-16/h3-8H,9H2,1-2H3 |
| InChIKey | IMPWPUUESLNZLF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.08 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|