C16H17FO2 — CID 61086897
(2,4-dimethylphenyl)-(5-fluoro-2-methoxyphenyl)methanol (PubChem CID 61086897) has the molecular formula C16H17FO2 and a molecular weight of 260.31 g/mol. Its IUPAC name is (2,4-dimethylphenyl)-(5-fluoro-2-methoxyphenyl)methanol.
| Compound Name | (2,4-dimethylphenyl)-(5-fluoro-2-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 61086897 |
| Molecular Formula | C16H17FO2 |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (2,4-dimethylphenyl)-(5-fluoro-2-methoxyphenyl)methanol |
| SMILES | COc1ccc(F)cc1C(O)c1ccc(C)cc1C |
| InChI | InChI=1S/C16H17FO2/c1-10-4-6-13(11(2)8-10)16(18)14-9-12(17)5-7-15(14)19-3/h4-9,16,18H,1-3H3 |
| InChIKey | KGCDFMDQGPZCOG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |