C15H16FNO — CID 82684351
(2-amino-5-fluorophenyl)-(2,4-dimethylphenyl)methanol (PubChem CID 82684351) has the molecular formula C15H16FNO and a molecular weight of 245.30 g/mol. Its IUPAC name is (2-amino-5-fluorophenyl)-(2,4-dimethylphenyl)methanol.
| Compound Name | (2-amino-5-fluorophenyl)-(2,4-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 82684351 |
| Molecular Formula | C15H16FNO |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (2-amino-5-fluorophenyl)-(2,4-dimethylphenyl)methanol |
| SMILES | Cc1ccc(C(O)c2cc(F)ccc2N)c(C)c1 |
| InChI | InChI=1S/C15H16FNO/c1-9-3-5-12(10(2)7-9)15(18)13-8-11(16)4-6-14(13)17/h3-8,15,18H,17H2,1-2H3 |
| InChIKey | GUPCBPJROOEJHZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|