C22H25NO6 — CID 134949174
dimethyl 2-(2-ethoxyphenyl)-1,4-dimethyl-3-oxo-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate (PubChem CID 134949174) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is dimethyl 2-(2-ethoxyphenyl)-1,4-dimethyl-3-oxo-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate.
| Compound Name | dimethyl 2-(2-ethoxyphenyl)-1,4-dimethyl-3-oxo-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate |
|---|---|
| PubChem CID | 134949174 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | dimethyl 2-(2-ethoxyphenyl)-1,4-dimethyl-3-oxo-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate |
| SMILES | CCOc1ccccc1-n1c(C)c2c(c(C)c1=O)CC(C(=O)OC)(C(=O)OC)C2 |
| InChI | InChI=1S/C22H25NO6/c1-6-29-18-10-8-7-9-17(18)23-14(3)16-12-22(20(25)27-4,21(26)28-5)11-15(16)13(2)19(23)24/h7-10H,6,11-12H2,1-5H3 |
| InChIKey | JITUZYSWOLJECI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|