C32H29NO5 — CID 72712652
dibenzyl 1,4-dimethyl-3-oxo-2-phenyl-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate (PubChem CID 72712652) has the molecular formula C32H29NO5 and a molecular weight of 507.59 g/mol. Its IUPAC name is dibenzyl 1,4-dimethyl-3-oxo-2-phenyl-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate.
| Compound Name | dibenzyl 1,4-dimethyl-3-oxo-2-phenyl-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate |
|---|---|
| PubChem CID | 72712652 |
| Molecular Formula | C32H29NO5 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | dibenzyl 1,4-dimethyl-3-oxo-2-phenyl-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate |
| SMILES | Cc1c2c(c(C)n(-c3ccccc3)c1=O)CC(C(=O)OCc1ccccc1)(C(=O)OCc1ccccc1)C2 |
| InChI | InChI=1S/C32H29NO5/c1-22-27-18-32(30(35)37-20-24-12-6-3-7-13-24,31(36)38-21-25-14-8-4-9-15-25)19-28(27)23(2)33(29(22)34)26-16-10-5-11-17-26/h3-17H,18-21H2,1-2H3 |
| InChIKey | RFHAVORIGAQPMK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|