C30H32O6 — CID 101422012
2-O,2-O'-dibenzyl 5-O-methyl (5R)-4,5,7-trimethyl-3,6-dihydro-1H-indene-2,2,5-tricarboxylate (PubChem CID 101422012) has the molecular formula C30H32O6 and a molecular weight of 488.58 g/mol. Its IUPAC name is 2-O,2-O'-dibenzyl 5-O-methyl (5R)-4,5,7-trimethyl-3,6-dihydro-1H-indene-2,2,5-tricarboxylate.
| Compound Name | 2-O,2-O'-dibenzyl 5-O-methyl (5R)-4,5,7-trimethyl-3,6-dihydro-1H-indene-2,2,5-tricarboxylate |
|---|---|
| PubChem CID | 101422012 |
| Molecular Formula | C30H32O6 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 2-O,2-O'-dibenzyl 5-O-methyl (5R)-4,5,7-trimethyl-3,6-dihydro-1H-indene-2,2,5-tricarboxylate |
| SMILES | COC(=O)[C@]1(C)CC(C)=C2CC(C(=O)OCc3ccccc3)(C(=O)OCc3ccccc3)CC2=C1C |
| InChI | InChI=1S/C30H32O6/c1-20-15-29(3,26(31)34-4)21(2)25-17-30(16-24(20)25,27(32)35-18-22-11-7-5-8-12-22)28(33)36-19-23-13-9-6-10-14-23/h5-14H,15-19H2,1-4H3/t29-/m1/s1 |
| InChIKey | XKEVZERXJRJSEU-GDLZYMKVSA-N |
| XLogP | 5.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|