C13H15NO3 — CID 90192308
benzyl 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate (PubChem CID 90192308) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is benzyl 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate.
| Compound Name | benzyl 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 90192308 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | benzyl 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate |
| SMILES | CC1=NOC(C)(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C13H15NO3/c1-10-8-13(2,17-14-10)12(15)16-9-11-6-4-3-5-7-11/h3-7H,8-9H2,1-2H3 |
| InChIKey | AEMBJEOGXNTXKU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |