C28H29NO4S — CID 72713053
dibenzyl 3-ethylimino-1,4-dimethyl-5,7-dihydrocyclopenta[c]thiopyran-6,6-dicarboxylate (PubChem CID 72713053) has the molecular formula C28H29NO4S and a molecular weight of 475.61 g/mol. Its IUPAC name is dibenzyl 3-ethylimino-1,4-dimethyl-5,7-dihydrocyclopenta[c]thiopyran-6,6-dicarboxylate.
| Compound Name | dibenzyl 3-ethylimino-1,4-dimethyl-5,7-dihydrocyclopenta[c]thiopyran-6,6-dicarboxylate |
|---|---|
| PubChem CID | 72713053 |
| Molecular Formula | C28H29NO4S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | dibenzyl 3-ethylimino-1,4-dimethyl-5,7-dihydrocyclopenta[c]thiopyran-6,6-dicarboxylate |
| SMILES | CC/N=c1\sc(C)c2c(c1C)CC(C(=O)OCc1ccccc1)(C(=O)OCc1ccccc1)C2 |
| InChI | InChI=1S/C28H29NO4S/c1-4-29-25-19(2)23-15-28(16-24(23)20(3)34-25,26(30)32-17-21-11-7-5-8-12-21)27(31)33-18-22-13-9-6-10-14-22/h5-14H,4,15-18H2,1-3H3/b29-25- |
| InChIKey | IIIQIRWBGFSKOI-GNVQSUKOSA-N |
| XLogP | 4.86 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|