C19H18O5 — CID 18939254
8-hydroxy-2-phenylmethoxycarbonyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid (PubChem CID 18939254) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is 8-hydroxy-2-phenylmethoxycarbonyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid.
| Compound Name | 8-hydroxy-2-phenylmethoxycarbonyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 18939254 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 8-hydroxy-2-phenylmethoxycarbonyl-3,4-dihydro-1H-naphthalene-2-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)OCc2ccccc2)CCc2cccc(O)c2C1 |
| InChI | InChI=1S/C19H18O5/c20-16-8-4-7-14-9-10-19(17(21)22,11-15(14)16)18(23)24-12-13-5-2-1-3-6-13/h1-8,20H,9-12H2,(H,21,22) |
| InChIKey | WICWTUDFTPCIML-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|