C17H21NO — CID 143731066
phenylmethanamine;5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 143731066) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is phenylmethanamine;5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | phenylmethanamine;5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 143731066 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | phenylmethanamine;5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | NCc1ccccc1.Oc1cccc2c1CCCC2 |
| InChI | InChI=1S/C10H12O.C7H9N/c11-10-7-3-5-8-4-1-2-6-9(8)10;8-6-7-4-2-1-3-5-7/h3,5,7,11H,1-2,4,6H2;1-5H,6,8H2 |
| InChIKey | QCTULOYATLFZOU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |