C37H43NO5Si2 — CID 101174400
dibenzyl 5-(4-methoxyphenyl)imino-4,6-bis(trimethylsilyl)-1,3-dihydropentalene-2,2-dicarboxylate (PubChem CID 101174400) has the molecular formula C37H43NO5Si2 and a molecular weight of 637.93 g/mol. Its IUPAC name is dibenzyl 5-(4-methoxyphenyl)imino-4,6-bis(trimethylsilyl)-1,3-dihydropentalene-2,2-dicarboxylate.
| Compound Name | dibenzyl 5-(4-methoxyphenyl)imino-4,6-bis(trimethylsilyl)-1,3-dihydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 101174400 |
| Molecular Formula | C37H43NO5Si2 |
| Molecular Weight | 637.93 g/mol |
| Exact Mass | 637.27 |
| IUPAC Name | dibenzyl 5-(4-methoxyphenyl)imino-4,6-bis(trimethylsilyl)-1,3-dihydropentalene-2,2-dicarboxylate |
| SMILES | COc1ccc(N=C2C([Si](C)(C)C)=C3CC(C(=O)OCc4ccccc4)(C(=O)OCc4ccccc4)CC3=C2[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C37H43NO5Si2/c1-41-29-20-18-28(19-21-29)38-32-33(44(2,3)4)30-22-37(23-31(30)34(32)45(5,6)7,35(39)42-24-26-14-10-8-11-15-26)36(40)43-25-27-16-12-9-13-17-27/h8-21H,22-25H2,1-7H3 |
| InChIKey | DQYXXESLOJPNHF-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.93 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|