C22H25NO4 — CID 102452861
dimethyl 1,4-dimethyl-3-[(1R)-1-phenylethyl]-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate (PubChem CID 102452861) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is dimethyl 1,4-dimethyl-3-[(1R)-1-phenylethyl]-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate.
| Compound Name | dimethyl 1,4-dimethyl-3-[(1R)-1-phenylethyl]-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate |
|---|---|
| PubChem CID | 102452861 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | dimethyl 1,4-dimethyl-3-[(1R)-1-phenylethyl]-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2c(C)nc([C@H](C)c3ccccc3)c(C)c2C1 |
| InChI | InChI=1S/C22H25NO4/c1-13(16-9-7-6-8-10-16)19-14(2)17-11-22(20(24)26-4,21(25)27-5)12-18(17)15(3)23-19/h6-10,13H,11-12H2,1-5H3/t13-/m1/s1 |
| InChIKey | BMUNPGBJJSJCMM-CYBMUJFWSA-N |
| XLogP | 3.28 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|