C29H27NO4 — CID 10928516
3-O-ethyl 1-O-methyl (1S,5R)-1-(benzhydrylideneamino)-5-phenylcyclopent-3-ene-1,3-dicarboxylate (PubChem CID 10928516) has the molecular formula C29H27NO4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 3-O-ethyl 1-O-methyl (1S,5R)-1-(benzhydrylideneamino)-5-phenylcyclopent-3-ene-1,3-dicarboxylate.
| Compound Name | 3-O-ethyl 1-O-methyl (1S,5R)-1-(benzhydrylideneamino)-5-phenylcyclopent-3-ene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 10928516 |
| Molecular Formula | C29H27NO4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 3-O-ethyl 1-O-methyl (1S,5R)-1-(benzhydrylideneamino)-5-phenylcyclopent-3-ene-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1=C[C@H](c2ccccc2)[C@](N=C(c2ccccc2)c2ccccc2)(C(=O)OC)C1 |
| InChI | InChI=1S/C29H27NO4/c1-3-34-27(31)24-19-25(21-13-7-4-8-14-21)29(20-24,28(32)33-2)30-26(22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-19,25H,3,20H2,1-2H3/t25-,29+/m1/s1 |
| InChIKey | LTFDOVXDJFPWGC-IRPSRAIASA-N |
| XLogP | 5.11 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|