C25H22N2O3 — CID 10092273
ethyl 5-(benzhydrylideneamino)-3-phenyl-4H-1,2-oxazole-5-carboxylate (PubChem CID 10092273) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is ethyl 5-(benzhydrylideneamino)-3-phenyl-4H-1,2-oxazole-5-carboxylate.
| Compound Name | ethyl 5-(benzhydrylideneamino)-3-phenyl-4H-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 10092273 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | ethyl 5-(benzhydrylideneamino)-3-phenyl-4H-1,2-oxazole-5-carboxylate |
| SMILES | CCOC(=O)C1(N=C(c2ccccc2)c2ccccc2)CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C25H22N2O3/c1-2-29-24(28)25(18-22(27-30-25)19-12-6-3-7-13-19)26-23(20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17H,2,18H2,1H3 |
| InChIKey | NBXKHNSXHXZMQK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|