C40H37NO3 — CID 101222816
ethyl (3S)-1-(benzhydrylideneamino)-3-trityloxycyclopentane-1-carboxylate (PubChem CID 101222816) has the molecular formula C40H37NO3 and a molecular weight of 579.74 g/mol. Its IUPAC name is ethyl (3S)-1-(benzhydrylideneamino)-3-trityloxycyclopentane-1-carboxylate.
| Compound Name | ethyl (3S)-1-(benzhydrylideneamino)-3-trityloxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 101222816 |
| Molecular Formula | C40H37NO3 |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | ethyl (3S)-1-(benzhydrylideneamino)-3-trityloxycyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(N=C(c2ccccc2)c2ccccc2)CC[C@H](OC(c2ccccc2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C40H37NO3/c1-2-43-38(42)39(41-37(31-18-8-3-9-19-31)32-20-10-4-11-21-32)29-28-36(30-39)44-40(33-22-12-5-13-23-33,34-24-14-6-15-25-34)35-26-16-7-17-27-35/h3-27,36H,2,28-30H2,1H3/t36-,39?/m0/s1 |
| InChIKey | QRODJBUQMSVTLK-XBNPSBKESA-N |
| XLogP | 8.39 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|