C23H31NO7 — CID 122659959
diethyl (5S)-1-benzoyl-5-(oxan-2-yloxy)piperidine-2,2-dicarboxylate (PubChem CID 122659959) has the molecular formula C23H31NO7 and a molecular weight of 433.50 g/mol. Its IUPAC name is diethyl (5S)-1-benzoyl-5-(oxan-2-yloxy)piperidine-2,2-dicarboxylate.
| Compound Name | diethyl (5S)-1-benzoyl-5-(oxan-2-yloxy)piperidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 122659959 |
| Molecular Formula | C23H31NO7 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | diethyl (5S)-1-benzoyl-5-(oxan-2-yloxy)piperidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC[C@H](OC2CCCCO2)CN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H31NO7/c1-3-28-21(26)23(22(27)29-4-2)14-13-18(31-19-12-8-9-15-30-19)16-24(23)20(25)17-10-6-5-7-11-17/h5-7,10-11,18-19H,3-4,8-9,12-16H2,1-2H3/t18-,19?/m0/s1 |
| InChIKey | KMIFSBIKWIJBTR-OYKVQYDMSA-N |
| XLogP | 2.70 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|