C17H23NO4 — CID 10946681
ethyl 2-(oxan-2-yl)-5-phenyl-1,2-oxazolidine-4-carboxylate (PubChem CID 10946681) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is ethyl 2-(oxan-2-yl)-5-phenyl-1,2-oxazolidine-4-carboxylate.
| Compound Name | ethyl 2-(oxan-2-yl)-5-phenyl-1,2-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 10946681 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | ethyl 2-(oxan-2-yl)-5-phenyl-1,2-oxazolidine-4-carboxylate |
| SMILES | CCOC(=O)C1CN(C2CCCCO2)OC1c1ccccc1 |
| InChI | InChI=1S/C17H23NO4/c1-2-20-17(19)14-12-18(15-10-6-7-11-21-15)22-16(14)13-8-4-3-5-9-13/h3-5,8-9,14-16H,2,6-7,10-12H2,1H3 |
| InChIKey | QQVBWYAPRPYHAY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |