C17H28O4 — CID 11208686
cis-ethyl (1S,2S)-2-(oxan-2-yloxy)-1-prop-2-enylcyclohexane-1-carboxylate (PubChem CID 11208686) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is cis-ethyl (1S,2S)-2-(oxan-2-yloxy)-1-prop-2-enylcyclohexane-1-carboxylate.
| Compound Name | cis-ethyl (1S,2S)-2-(oxan-2-yloxy)-1-prop-2-enylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11208686 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | cis-ethyl (1S,2S)-2-(oxan-2-yloxy)-1-prop-2-enylcyclohexane-1-carboxylate |
| SMILES | C=CC[C@@]1(C(=O)OCC)CCCC[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C17H28O4/c1-3-11-17(16(18)19-4-2)12-7-5-9-14(17)21-15-10-6-8-13-20-15/h3,14-15H,1,4-13H2,2H3/t14-,15?,17+/m0/s1 |
| InChIKey | DHULQQAKHIDPNP-XJIUDMAQSA-N |
| XLogP | 3.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|