C23H38O6 — CID 54277252
diethyl 2-[3-methyl-3-(oxan-2-yloxy)oct-1-enyl]cyclopropane-1,1-dicarboxylate (PubChem CID 54277252) has the molecular formula C23H38O6 and a molecular weight of 410.55 g/mol. Its IUPAC name is diethyl 2-[3-methyl-3-(oxan-2-yloxy)oct-1-enyl]cyclopropane-1,1-dicarboxylate.
| Compound Name | diethyl 2-[3-methyl-3-(oxan-2-yloxy)oct-1-enyl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 54277252 |
| Molecular Formula | C23H38O6 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | diethyl 2-[3-methyl-3-(oxan-2-yloxy)oct-1-enyl]cyclopropane-1,1-dicarboxylate |
| SMILES | CCCCCC(C)(C=CC1CC1(C(=O)OCC)C(=O)OCC)OC1CCCCO1 |
| InChI | InChI=1S/C23H38O6/c1-5-8-10-14-22(4,29-19-12-9-11-16-28-19)15-13-18-17-23(18,20(24)26-6-2)21(25)27-7-3/h13,15,18-19H,5-12,14,16-17H2,1-4H3 |
| InChIKey | ROGPFMJXELVDPA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|