C21H32O5 — CID 54060224
2-[3-ethynyl-3-(oxan-2-yloxy)oct-1-enyl]-5-hydroxycyclopentane-1-carboxylic acid (PubChem CID 54060224) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is 2-[3-ethynyl-3-(oxan-2-yloxy)oct-1-enyl]-5-hydroxycyclopentane-1-carboxylic acid.
| Compound Name | 2-[3-ethynyl-3-(oxan-2-yloxy)oct-1-enyl]-5-hydroxycyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 54060224 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 2-[3-ethynyl-3-(oxan-2-yloxy)oct-1-enyl]-5-hydroxycyclopentane-1-carboxylic acid |
| SMILES | C#CC(C=CC1CCC(O)C1C(=O)O)(CCCCC)OC1CCCCO1 |
| InChI | InChI=1S/C21H32O5/c1-3-5-7-13-21(4-2,26-18-9-6-8-15-25-18)14-12-16-10-11-17(22)19(16)20(23)24/h2,12,14,16-19,22H,3,5-11,13,15H2,1H3,(H,23,24) |
| InChIKey | LZECOJXTKYEUAK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|