C32H54O7 — CID 70485134
methyl 7-[(1R,2R,3R,5S)-5-hydroxy-2-[3-methyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 70485134) has the molecular formula C32H54O7 and a molecular weight of 550.78 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-5-hydroxy-2-[3-methyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-5-hydroxy-2-[3-methyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70485134 |
| Molecular Formula | C32H54O7 |
| Molecular Weight | 550.78 g/mol |
| Exact Mass | 550.39 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-5-hydroxy-2-[3-methyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(C)(C=C[C@@H]1[C@@H](CC=CCCCC(=O)OC)[C@@H](O)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C32H54O7/c1-4-5-12-20-32(2,39-31-18-11-14-23-37-31)21-19-26-25(15-8-6-7-9-16-29(34)35-3)27(33)24-28(26)38-30-17-10-13-22-36-30/h6,8,19,21,25-28,30-31,33H,4-5,7,9-18,20,22-24H2,1-3H3/t25-,26-,27+,28-,30?,31?,32?/m1/s1 |
| InChIKey | LEVBTTGWORHBJS-ZDDYAQQJSA-N |
| XLogP | 6.62 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.78 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|