C22H37NO6 — CID 54200942
methyl 7-[(1S,2S,3S,5R)-5-hydroxy-2-morpholin-4-yl-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 54200942) has the molecular formula C22H37NO6 and a molecular weight of 411.54 g/mol. Its IUPAC name is methyl 7-[(1S,2S,3S,5R)-5-hydroxy-2-morpholin-4-yl-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1S,2S,3S,5R)-5-hydroxy-2-morpholin-4-yl-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 54200942 |
| Molecular Formula | C22H37NO6 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | methyl 7-[(1S,2S,3S,5R)-5-hydroxy-2-morpholin-4-yl-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CC[C@H]1[C@H](N2CCOCC2)[C@@H](OC2CCCCO2)C[C@H]1O |
| InChI | InChI=1S/C22H37NO6/c1-26-20(25)9-5-3-2-4-8-17-18(24)16-19(29-21-10-6-7-13-28-21)22(17)23-11-14-27-15-12-23/h2,4,17-19,21-22,24H,3,5-16H2,1H3/t17-,18-,19+,21?,22+/m1/s1 |
| InChIKey | PPEOEXFQELNVMT-AHQOGOERSA-N |
| XLogP | 2.27 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|