C32H47ClO9 — CID 56630541
methyl 7-[(1S,2R,3R,5S)-2-[3-(4-chlorophenoxy)-2-(oxan-2-yloxy)propoxy]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 56630541) has the molecular formula C32H47ClO9 and a molecular weight of 611.17 g/mol. Its IUPAC name is methyl 7-[(1S,2R,3R,5S)-2-[3-(4-chlorophenoxy)-2-(oxan-2-yloxy)propoxy]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1S,2R,3R,5S)-2-[3-(4-chlorophenoxy)-2-(oxan-2-yloxy)propoxy]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 56630541 |
| Molecular Formula | C32H47ClO9 |
| Molecular Weight | 611.17 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | methyl 7-[(1S,2R,3R,5S)-2-[3-(4-chlorophenoxy)-2-(oxan-2-yloxy)propoxy]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CC[C@@H]1[C@@H](OCC(COc2ccc(Cl)cc2)OC2CCCCO2)[C@H](OC2CCCCO2)C[C@@H]1O |
| InChI | InChI=1S/C32H47ClO9/c1-36-29(35)11-5-3-2-4-10-26-27(34)20-28(42-31-13-7-9-19-38-31)32(26)40-22-25(41-30-12-6-8-18-37-30)21-39-24-16-14-23(33)15-17-24/h2,4,14-17,25-28,30-32,34H,3,5-13,18-22H2,1H3/t25?,26-,27-,28+,30?,31?,32+/m0/s1 |
| InChIKey | YPQFMNGUYGGSPB-MHIWGITJSA-N |
| XLogP | 5.60 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.17 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|