5-amino-3-phenyl-4H-1,2-oxazole-5-carboxylic acid

C10H10N2O3 — CID 11790369

IUPAC5-amino-3-phenyl-4H-1,2-oxazole-5-carboxylic acid
SMILESNC1(C(=O)O)CC(c2ccccc2)=NO1
InChIInChI=1S/C10H10N2O3/c11-10(9(13)14)6-8(12-15-10)7-4-2-1-3-5-7/h1-5H,6,11H2,(H,13,14)
InChIKeyOUFREUQOQPBICS-UHFFFAOYSA-N
MW206.20 g/mol
LogP0.55
Rot. Bonds2

About 5-amino-3-phenyl-4H-1,2-oxazole-5-carboxylic acid

5-amino-3-phenyl-4H-1,2-oxazole-5-carboxylic acid (PubChem CID 11790369) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 5-amino-3-phenyl-4H-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name5-amino-3-phenyl-4H-1,2-oxazole-5-carboxylic acid
PubChem CID11790369
Molecular FormulaC10H10N2O3
Molecular Weight206.20 g/mol
Exact Mass206.07
IUPAC Name5-amino-3-phenyl-4H-1,2-oxazole-5-carboxylic acid
SMILESNC1(C(=O)O)CC(c2ccccc2)=NO1
InChIInChI=1S/C10H10N2O3/c11-10(9(13)14)6-8(12-15-10)7-4-2-1-3-5-7/h1-5H,6,11H2,(H,13,14)
InChIKeyOUFREUQOQPBICS-UHFFFAOYSA-N
XLogP0.55
TPSA84.91 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.20
LogP ≤ 50.55
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-amino-3-phenyl-4H-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-amino-3-phenyl-4H-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 5-amino-3-phenyl-4H-1,2-oxazole-5-carboxylic acid (CID 11790369) is 5-amino-3-phenyl-4H-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 5-amino-3-phenyl-4H-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 5-amino-3-phenyl-4H-1,2-oxazole-5-carboxylic acid is NC1(C(=O)O)CC(c2ccccc2)=NO1.
What is the InChIKey of 5-amino-3-phenyl-4H-1,2-oxazole-5-carboxylic acid?
The InChIKey is OUFREUQOQPBICS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O3/c11-10(9(13)14)6-8(12-15-10)7-4-2-1-3-5-7/h1-5H,6,11H2,(H,13,14).
What are the key properties of 5-amino-3-phenyl-4H-1,2-oxazole-5-carboxylic acid?
5-amino-3-phenyl-4H-1,2-oxazole-5-carboxylic acid has a molecular weight of 206.20 g/mol, XLogP of 0.55, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-phenyl-4H-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 11790369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).