C17H22N2O2 — CID 97465776
azepan-1-yl-[(5R)-5-methyl-3-phenyl-4H-1,2-oxazol-5-yl]methanone (PubChem CID 97465776) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is azepan-1-yl-[(5R)-5-methyl-3-phenyl-4H-1,2-oxazol-5-yl]methanone.
| Compound Name | azepan-1-yl-[(5R)-5-methyl-3-phenyl-4H-1,2-oxazol-5-yl]methanone |
|---|---|
| PubChem CID | 97465776 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | azepan-1-yl-[(5R)-5-methyl-3-phenyl-4H-1,2-oxazol-5-yl]methanone |
| SMILES | C[C@]1(C(=O)N2CCCCCC2)CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C17H22N2O2/c1-17(16(20)19-11-7-2-3-8-12-19)13-15(18-21-17)14-9-5-4-6-10-14/h4-6,9-10H,2-3,7-8,11-13H2,1H3/t17-/m1/s1 |
| InChIKey | YRPUPCNTICHTEP-QGZVFWFLSA-N |
| XLogP | 2.97 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |