C12H14N2O2 — CID 95051944
(5R)-N,5-dimethyl-3-phenyl-4H-1,2-oxazole-5-carboxamide (PubChem CID 95051944) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is (5R)-N,5-dimethyl-3-phenyl-4H-1,2-oxazole-5-carboxamide.
| Compound Name | (5R)-N,5-dimethyl-3-phenyl-4H-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 95051944 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (5R)-N,5-dimethyl-3-phenyl-4H-1,2-oxazole-5-carboxamide |
| SMILES | CNC(=O)[C@@]1(C)CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C12H14N2O2/c1-12(11(15)13-2)8-10(14-16-12)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H,13,15)/t12-/m1/s1 |
| InChIKey | OUKFKYUKFPGYFJ-GFCCVEGCSA-N |
| XLogP | 1.32 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |