C16H23BN2O4 — CID 174058339
[3-methyl-1-[(5-methyl-3-phenyl-4H-1,2-oxazole-5-carbonyl)amino]butyl]boronic acid (PubChem CID 174058339) has the molecular formula C16H23BN2O4 and a molecular weight of 318.18 g/mol. Its IUPAC name is [3-methyl-1-[(5-methyl-3-phenyl-4H-1,2-oxazole-5-carbonyl)amino]butyl]boronic acid.
| Compound Name | [3-methyl-1-[(5-methyl-3-phenyl-4H-1,2-oxazole-5-carbonyl)amino]butyl]boronic acid |
|---|---|
| PubChem CID | 174058339 |
| Molecular Formula | C16H23BN2O4 |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | [3-methyl-1-[(5-methyl-3-phenyl-4H-1,2-oxazole-5-carbonyl)amino]butyl]boronic acid |
| SMILES | CC(C)CC(NC(=O)C1(C)CC(c2ccccc2)=NO1)B(O)O |
| InChI | InChI=1S/C16H23BN2O4/c1-11(2)9-14(17(21)22)18-15(20)16(3)10-13(19-23-16)12-7-5-4-6-8-12/h4-8,11,14,21-22H,9-10H2,1-3H3,(H,18,20) |
| InChIKey | ZBMZWZHQOWGLNB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|